C44H26N2O — CID 176994591
4-[9-(4-cyanophenyl)dibenzofuran-3-yl]-2-phenyl-6-(4-phenylphenyl)benzonitrile (PubChem CID 176994591) has the molecular formula C44H26N2O and a molecular weight of 598.71 g/mol. Its IUPAC name is 4-[9-(4-cyanophenyl)dibenzofuran-3-yl]-2-phenyl-6-(4-phenylphenyl)benzonitrile.
| Compound Name | 4-[9-(4-cyanophenyl)dibenzofuran-3-yl]-2-phenyl-6-(4-phenylphenyl)benzonitrile |
|---|---|
| PubChem CID | 176994591 |
| Molecular Formula | C44H26N2O |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 4-[9-(4-cyanophenyl)dibenzofuran-3-yl]-2-phenyl-6-(4-phenylphenyl)benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc3oc4cc(-c5cc(-c6ccccc6)c(C#N)c(-c6ccc(-c7ccccc7)cc6)c5)ccc4c23)cc1 |
| InChI | InChI=1S/C44H26N2O/c45-27-29-14-16-33(17-15-29)37-12-7-13-42-44(37)38-23-22-35(26-43(38)47-42)36-24-39(32-10-5-2-6-11-32)41(28-46)40(25-36)34-20-18-31(19-21-34)30-8-3-1-4-9-30/h1-26H |
| InChIKey | HTJYSQOSIXMMLA-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 60.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |