C38H20N2S2 — CID 146354659
4-(4-cyanophenyl)-2,6-di(dibenzothiophen-3-yl)benzonitrile (PubChem CID 146354659) has the molecular formula C38H20N2S2 and a molecular weight of 568.73 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-2,6-di(dibenzothiophen-3-yl)benzonitrile.
| Compound Name | 4-(4-cyanophenyl)-2,6-di(dibenzothiophen-3-yl)benzonitrile |
|---|---|
| PubChem CID | 146354659 |
| Molecular Formula | C38H20N2S2 |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 4-(4-cyanophenyl)-2,6-di(dibenzothiophen-3-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc4c(c3)sc3ccccc34)c(C#N)c(-c3ccc4c(c3)sc3ccccc34)c2)cc1 |
| InChI | InChI=1S/C38H20N2S2/c39-21-23-9-11-24(12-10-23)27-17-32(25-13-15-30-28-5-1-3-7-35(28)41-37(30)19-25)34(22-40)33(18-27)26-14-16-31-29-6-2-4-8-36(29)42-38(31)20-26/h1-20H |
| InChIKey | LHKUQCRNXKVBRY-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |