C20H10N2S — CID 156576874
4-dibenzothiophen-3-ylbenzene-1,3-dicarbonitrile (PubChem CID 156576874) has the molecular formula C20H10N2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-dibenzothiophen-3-ylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-dibenzothiophen-3-ylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 156576874 |
| Molecular Formula | C20H10N2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-dibenzothiophen-3-ylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)sc2ccccc23)c(C#N)c1 |
| InChI | InChI=1S/C20H10N2S/c21-11-13-5-7-16(15(9-13)12-22)14-6-8-18-17-3-1-2-4-19(17)23-20(18)10-14/h1-10H |
| InChIKey | JOESNWUTNTVCIE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |