C38H20N2OS — CID 146355597
2-(3-dibenzofuran-3-yl-5-dibenzothiophen-3-ylphenyl)benzene-1,4-dicarbonitrile (PubChem CID 146355597) has the molecular formula C38H20N2OS and a molecular weight of 552.66 g/mol. Its IUPAC name is 2-(3-dibenzofuran-3-yl-5-dibenzothiophen-3-ylphenyl)benzene-1,4-dicarbonitrile.
| Compound Name | 2-(3-dibenzofuran-3-yl-5-dibenzothiophen-3-ylphenyl)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 146355597 |
| Molecular Formula | C38H20N2OS |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 2-(3-dibenzofuran-3-yl-5-dibenzothiophen-3-ylphenyl)benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1ccc(C#N)c(-c2cc(-c3ccc4c(c3)oc3ccccc34)cc(-c3ccc4c(c3)sc3ccccc34)c2)c1 |
| InChI | InChI=1S/C38H20N2OS/c39-21-23-9-10-26(22-40)34(15-23)29-17-27(24-11-13-31-30-5-1-3-7-35(30)41-36(31)19-24)16-28(18-29)25-12-14-33-32-6-2-4-8-37(32)42-38(33)20-25/h1-20H |
| InChIKey | LDNOOEPCPJKFFD-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 60.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |