C39H19N3OS — CID 146355177
7-[4-(8-cyanodibenzothiophen-3-yl)-2-(2-cyanophenyl)phenyl]dibenzofuran-2-carbonitrile (PubChem CID 146355177) has the molecular formula C39H19N3OS and a molecular weight of 577.67 g/mol. Its IUPAC name is 7-[4-(8-cyanodibenzothiophen-3-yl)-2-(2-cyanophenyl)phenyl]dibenzofuran-2-carbonitrile.
| Compound Name | 7-[4-(8-cyanodibenzothiophen-3-yl)-2-(2-cyanophenyl)phenyl]dibenzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 146355177 |
| Molecular Formula | C39H19N3OS |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 7-[4-(8-cyanodibenzothiophen-3-yl)-2-(2-cyanophenyl)phenyl]dibenzofuran-2-carbonitrile |
| SMILES | N#Cc1ccc2oc3cc(-c4ccc(-c5ccc6c(c5)sc5ccc(C#N)cc56)cc4-c4ccccc4C#N)ccc3c2c1 |
| InChI | InChI=1S/C39H19N3OS/c40-20-23-5-13-36-34(15-23)31-11-9-27(18-37(31)43-36)30-10-7-25(17-33(30)29-4-2-1-3-28(29)22-42)26-8-12-32-35-16-24(21-41)6-14-38(35)44-39(32)19-26/h1-19H |
| InChIKey | DFTWQYOIRSQESI-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |