C20H12N2 — CID 126496791
5-(2-phenylphenyl)benzene-1,3-dicarbonitrile (PubChem CID 126496791) has the molecular formula C20H12N2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-(2-phenylphenyl)benzene-1,3-dicarbonitrile.
| Compound Name | 5-(2-phenylphenyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 126496791 |
| Molecular Formula | C20H12N2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-(2-phenylphenyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C20H12N2/c21-13-15-10-16(14-22)12-18(11-15)20-9-5-4-8-19(20)17-6-2-1-3-7-17/h1-12H |
| InChIKey | DWAGSFRSZUVNKQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |