About 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile
5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile (PubChem CID 177469276) has the molecular formula C30H14N4
and a molecular weight of 430.47 g/mol. Its IUPAC name is 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile |
| PubChem CID | 177469276 |
| Molecular Formula | C30H14N4 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccc(-c3cc(C#N)cc(C#N)c3)c3cc4ccccc4cc23)c1 |
| InChI | InChI=1S/C30H14N4/c31-15-19-7-20(16-32)10-25(9-19)27-5-6-28(26-11-21(17-33)8-22(12-26)18-34)30-14-24-4-2-1-3-23(24)13-29(27)30/h1-14H |
| InChIKey | RDYIGCDIKVXYNI-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile?
The IUPAC name of 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile (CID 177469276) is 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile.
What is the SMILES notation for 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile?
The canonical SMILES for 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile is N#Cc1cc(C#N)cc(-c2ccc(-c3cc(C#N)cc(C#N)c3)c3cc4ccccc4cc23)c1.
What is the InChIKey of 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile?
The InChIKey is RDYIGCDIKVXYNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H14N4/c31-15-19-7-20(16-32)10-25(9-19)27-5-6-28(26-11-21(17-33)8-22(12-26)18-34)30-14-24-4-2-1-3-23(24)13-29(27)30/h1-14H.
What are the key properties of 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile?
5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile has a molecular weight of 430.47 g/mol, XLogP of 6.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3,5-dicyanophenyl)anthracen-1-yl]benzene-1,3-dicarbonitrile is sourced from PubChem (CID 177469276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).