C16H9F6N — CID 134956845
4-[[3,5-bis(trifluoromethyl)phenyl]methyl]benzonitrile (PubChem CID 134956845) has the molecular formula C16H9F6N and a molecular weight of 329.24 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methyl]benzonitrile.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methyl]benzonitrile |
|---|---|
| PubChem CID | 134956845 |
| Molecular Formula | C16H9F6N |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H9F6N/c17-15(18,19)13-6-12(7-14(8-13)16(20,21)22)5-10-1-3-11(9-23)4-2-10/h1-4,6-8H,5H2 |
| InChIKey | WJLUMVGRSHUGCH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |