C16H14F5NO3 — CID 54247050
2-[4-(difluoromethoxy)-2-(trifluoromethyl)benzoyl]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 54247050) has the molecular formula C16H14F5NO3 and a molecular weight of 363.28 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)-2-(trifluoromethyl)benzoyl]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | 2-[4-(difluoromethoxy)-2-(trifluoromethyl)benzoyl]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 54247050 |
| Molecular Formula | C16H14F5NO3 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[4-(difluoromethoxy)-2-(trifluoromethyl)benzoyl]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CC(C)(C)C(=O)C(C#N)C(=O)c1ccc(OC(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C16H14F5NO3/c1-15(2,3)13(24)10(7-22)12(23)9-5-4-8(25-14(17)18)6-11(9)16(19,20)21/h4-6,10,14H,1-3H3 |
| InChIKey | QTZOZILTSRLLRH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|