C14H4F10O — CID 134628110
1-[4-(difluoromethoxy)-2-(trifluoromethyl)phenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 134628110) has the molecular formula C14H4F10O and a molecular weight of 378.17 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-2-(trifluoromethyl)phenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[4-(difluoromethoxy)-2-(trifluoromethyl)phenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 134628110 |
| Molecular Formula | C14H4F10O |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1-[4-(difluoromethoxy)-2-(trifluoromethyl)phenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(-c2ccc(OC(F)F)cc2C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14H4F10O/c15-8-7(9(16)11(18)12(19)10(8)17)5-2-1-4(25-13(20)21)3-6(5)14(22,23)24/h1-3,13H |
| InChIKey | KEBVXJWHETUYOZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|