C9H3F8IO — CID 134638592
5-(difluoromethoxy)-1-iodo-2,3-bis(trifluoromethyl)benzene (PubChem CID 134638592) has the molecular formula C9H3F8IO and a molecular weight of 406.01 g/mol. Its IUPAC name is 5-(difluoromethoxy)-1-iodo-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 5-(difluoromethoxy)-1-iodo-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134638592 |
| Molecular Formula | C9H3F8IO |
| Molecular Weight | 406.01 g/mol |
| Exact Mass | 405.91 |
| IUPAC Name | 5-(difluoromethoxy)-1-iodo-2,3-bis(trifluoromethyl)benzene |
| SMILES | FC(F)Oc1cc(I)c(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H3F8IO/c10-7(11)19-3-1-4(8(12,13)14)6(5(18)2-3)9(15,16)17/h1-2,7H |
| InChIKey | GSMWTVPRVMVDTF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.01 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|