About 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol
5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol (PubChem CID 134639057) has the molecular formula C9H4F8O2
and a molecular weight of 296.11 g/mol. Its IUPAC name is 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol |
| PubChem CID | 134639057 |
| Molecular Formula | C9H4F8O2 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol |
| SMILES | Oc1cc(OC(F)F)cc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H4F8O2/c10-7(11)19-3-1-4(8(12,13)14)6(5(18)2-3)9(15,16)17/h1-2,7,18H |
| InChIKey | LFFPIKLNKQIXJT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol?
The IUPAC name of 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol (CID 134639057) is 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol.
What is the SMILES notation for 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol?
The canonical SMILES for 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol is Oc1cc(OC(F)F)cc(C(F)(F)F)c1C(F)(F)F.
What is the InChIKey of 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol?
The InChIKey is LFFPIKLNKQIXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F8O2/c10-7(11)19-3-1-4(8(12,13)14)6(5(18)2-3)9(15,16)17/h1-2,7,18H.
What are the key properties of 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol?
5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol has a molecular weight of 296.11 g/mol, XLogP of 4.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol is sourced from PubChem (CID 134639057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).