C9H4F8O2 — CID 134639057
5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol (PubChem CID 134639057) has the molecular formula C9H4F8O2 and a molecular weight of 296.11 g/mol. Its IUPAC name is 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol.
| Compound Name | 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 134639057 |
| Molecular Formula | C9H4F8O2 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 5-(difluoromethoxy)-2,3-bis(trifluoromethyl)phenol |
| SMILES | Oc1cc(OC(F)F)cc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H4F8O2/c10-7(11)19-3-1-4(8(12,13)14)6(5(18)2-3)9(15,16)17/h1-2,7,18H |
| InChIKey | LFFPIKLNKQIXJT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |