C12H11F5O2 — CID 171031662
1-[5-(difluoromethoxy)-3-ethyl-2-(trifluoromethyl)phenyl]ethanone (PubChem CID 171031662) has the molecular formula C12H11F5O2 and a molecular weight of 282.21 g/mol. Its IUPAC name is 1-[5-(difluoromethoxy)-3-ethyl-2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[5-(difluoromethoxy)-3-ethyl-2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171031662 |
| Molecular Formula | C12H11F5O2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-[5-(difluoromethoxy)-3-ethyl-2-(trifluoromethyl)phenyl]ethanone |
| SMILES | CCc1cc(OC(F)F)cc(C(C)=O)c1C(F)(F)F |
| InChI | InChI=1S/C12H11F5O2/c1-3-7-4-8(19-11(13)14)5-9(6(2)18)10(7)12(15,16)17/h4-5,11H,3H2,1-2H3 |
| InChIKey | WWHWYDDTJCKRTK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |