C9H6F6OS — CID 134639183
5-methylsulfanyl-2,3-bis(trifluoromethyl)phenol (PubChem CID 134639183) has the molecular formula C9H6F6OS and a molecular weight of 276.20 g/mol. Its IUPAC name is 5-methylsulfanyl-2,3-bis(trifluoromethyl)phenol.
| Compound Name | 5-methylsulfanyl-2,3-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 134639183 |
| Molecular Formula | C9H6F6OS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 5-methylsulfanyl-2,3-bis(trifluoromethyl)phenol |
| SMILES | CSc1cc(O)c(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F6OS/c1-17-4-2-5(8(10,11)12)7(6(16)3-4)9(13,14)15/h2-3,16H,1H3 |
| InChIKey | XVYYLVGUBSZWOR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |