C9H2F10O — CID 177310984
4-fluoro-2,3,5-tris(trifluoromethyl)phenol (PubChem CID 177310984) has the molecular formula C9H2F10O and a molecular weight of 316.09 g/mol. Its IUPAC name is 4-fluoro-2,3,5-tris(trifluoromethyl)phenol.
| Compound Name | 4-fluoro-2,3,5-tris(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 177310984 |
| Molecular Formula | C9H2F10O |
| Molecular Weight | 316.09 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 4-fluoro-2,3,5-tris(trifluoromethyl)phenol |
| SMILES | Oc1cc(C(F)(F)F)c(F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H2F10O/c10-6-2(7(11,12)13)1-3(20)4(8(14,15)16)5(6)9(17,18)19/h1,20H |
| InChIKey | VUAYDKUTCYJJPG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.09 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |