C7H2F6S — CID 139906003
2,3,4-trifluoro-5-(trifluoromethyl)benzenethiol (PubChem CID 139906003) has the molecular formula C7H2F6S and a molecular weight of 232.15 g/mol. Its IUPAC name is 2,3,4-trifluoro-5-(trifluoromethyl)benzenethiol.
| Compound Name | 2,3,4-trifluoro-5-(trifluoromethyl)benzenethiol |
|---|---|
| PubChem CID | 139906003 |
| Molecular Formula | C7H2F6S |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 2,3,4-trifluoro-5-(trifluoromethyl)benzenethiol |
| SMILES | Fc1c(S)cc(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C7H2F6S/c8-4-2(7(11,12)13)1-3(14)5(9)6(4)10/h1,14H |
| InChIKey | SYVPOXJESQMICI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|