About 3,5-dibromo-2,4-difluorobenzenethiol
3,5-dibromo-2,4-difluorobenzenethiol (PubChem CID 121228022) has the molecular formula C6H2Br2F2S
and a molecular weight of 303.95 g/mol. Its IUPAC name is 3,5-dibromo-2,4-difluorobenzenethiol.
Molecular Properties
| Compound Name | 3,5-dibromo-2,4-difluorobenzenethiol |
| PubChem CID | 121228022 |
| Molecular Formula | C6H2Br2F2S |
| Molecular Weight | 303.95 g/mol |
| Exact Mass | 301.82 |
| IUPAC Name | 3,5-dibromo-2,4-difluorobenzenethiol |
| SMILES | Fc1c(S)cc(Br)c(F)c1Br |
| InChI | InChI=1S/C6H2Br2F2S/c7-2-1-3(11)6(10)4(8)5(2)9/h1,11H |
| InChIKey | ZMIARGJREZIHLW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibromo-2,4-difluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-2,4-difluorobenzenethiol?
The IUPAC name of 3,5-dibromo-2,4-difluorobenzenethiol (CID 121228022) is 3,5-dibromo-2,4-difluorobenzenethiol.
What is the SMILES notation for 3,5-dibromo-2,4-difluorobenzenethiol?
The canonical SMILES for 3,5-dibromo-2,4-difluorobenzenethiol is Fc1c(S)cc(Br)c(F)c1Br.
What is the InChIKey of 3,5-dibromo-2,4-difluorobenzenethiol?
The InChIKey is ZMIARGJREZIHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br2F2S/c7-2-1-3(11)6(10)4(8)5(2)9/h1,11H.
What are the key properties of 3,5-dibromo-2,4-difluorobenzenethiol?
3,5-dibromo-2,4-difluorobenzenethiol has a molecular weight of 303.95 g/mol, XLogP of 3.78, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2,4-difluorobenzenethiol is sourced from PubChem (CID 121228022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).