C6H3Br3S2 — CID 22238714
3,4,5-tribromobenzene-1,2-dithiol (PubChem CID 22238714) has the molecular formula C6H3Br3S2 and a molecular weight of 378.94 g/mol. Its IUPAC name is 3,4,5-tribromobenzene-1,2-dithiol.
| Compound Name | 3,4,5-tribromobenzene-1,2-dithiol |
|---|---|
| PubChem CID | 22238714 |
| Molecular Formula | C6H3Br3S2 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 375.72 |
| IUPAC Name | 3,4,5-tribromobenzene-1,2-dithiol |
| SMILES | Sc1cc(Br)c(Br)c(Br)c1S |
| InChI | InChI=1S/C6H3Br3S2/c7-2-1-3(10)6(11)5(9)4(2)8/h1,10-11H |
| InChIKey | MBTDKTRAPFVPLW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|