About 5-bromo-2,4-dichlorobenzenethiol
5-bromo-2,4-dichlorobenzenethiol (PubChem CID 171004591) has the molecular formula C6H3BrCl2S
and a molecular weight of 257.97 g/mol. Its IUPAC name is 5-bromo-2,4-dichlorobenzenethiol.
Molecular Properties
| Compound Name | 5-bromo-2,4-dichlorobenzenethiol |
| PubChem CID | 171004591 |
| Molecular Formula | C6H3BrCl2S |
| Molecular Weight | 257.97 g/mol |
| Exact Mass | 255.85 |
| IUPAC Name | 5-bromo-2,4-dichlorobenzenethiol |
| SMILES | Sc1cc(Br)c(Cl)cc1Cl |
| InChI | InChI=1S/C6H3BrCl2S/c7-3-1-6(10)5(9)2-4(3)8/h1-2,10H |
| InChIKey | FCKOEFLENMBTFB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2,4-dichlorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-dichlorobenzenethiol?
The IUPAC name of 5-bromo-2,4-dichlorobenzenethiol (CID 171004591) is 5-bromo-2,4-dichlorobenzenethiol.
What is the SMILES notation for 5-bromo-2,4-dichlorobenzenethiol?
The canonical SMILES for 5-bromo-2,4-dichlorobenzenethiol is Sc1cc(Br)c(Cl)cc1Cl.
What is the InChIKey of 5-bromo-2,4-dichlorobenzenethiol?
The InChIKey is FCKOEFLENMBTFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrCl2S/c7-3-1-6(10)5(9)2-4(3)8/h1-2,10H.
What are the key properties of 5-bromo-2,4-dichlorobenzenethiol?
5-bromo-2,4-dichlorobenzenethiol has a molecular weight of 257.97 g/mol, XLogP of 4.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-dichlorobenzenethiol is sourced from PubChem (CID 171004591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).