C6H5ClS3 — CID 131858025
2-chlorobenzene-1,3,5-trithiol (PubChem CID 131858025) has the molecular formula C6H5ClS3 and a molecular weight of 208.76 g/mol. Its IUPAC name is 2-chlorobenzene-1,3,5-trithiol.
| Compound Name | 2-chlorobenzene-1,3,5-trithiol |
|---|---|
| PubChem CID | 131858025 |
| Molecular Formula | C6H5ClS3 |
| Molecular Weight | 208.76 g/mol |
| Exact Mass | 207.92 |
| IUPAC Name | 2-chlorobenzene-1,3,5-trithiol |
| SMILES | Sc1cc(S)c(Cl)c(S)c1 |
| InChI | InChI=1S/C6H5ClS3/c7-6-4(9)1-3(8)2-5(6)10/h1-2,8-10H |
| InChIKey | SAXGGPIRQOHDBQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|