About 2,7-dibromo-3,8-dichlorothianthrene
2,7-dibromo-3,8-dichlorothianthrene (PubChem CID 19906812) has the molecular formula C12H4Br2Cl2S2
and a molecular weight of 443.01 g/mol. Its IUPAC name is 2,7-dibromo-3,8-dichlorothianthrene.
Molecular Properties
| Compound Name | 2,7-dibromo-3,8-dichlorothianthrene |
| PubChem CID | 19906812 |
| Molecular Formula | C12H4Br2Cl2S2 |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 439.75 |
| IUPAC Name | 2,7-dibromo-3,8-dichlorothianthrene |
| SMILES | Clc1cc2c(cc1Br)Sc1cc(Cl)c(Br)cc1S2 |
| InChI | InChI=1S/C12H4Br2Cl2S2/c13-5-1-9-11(3-7(5)15)18-10-2-6(14)8(16)4-12(10)17-9/h1-4H |
| InChIKey | XEECZUOYJVXRSU-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dibromo-3,8-dichlorothianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-3,8-dichlorothianthrene?
The IUPAC name of 2,7-dibromo-3,8-dichlorothianthrene (CID 19906812) is 2,7-dibromo-3,8-dichlorothianthrene.
What is the SMILES notation for 2,7-dibromo-3,8-dichlorothianthrene?
The canonical SMILES for 2,7-dibromo-3,8-dichlorothianthrene is Clc1cc2c(cc1Br)Sc1cc(Cl)c(Br)cc1S2.
What is the InChIKey of 2,7-dibromo-3,8-dichlorothianthrene?
The InChIKey is XEECZUOYJVXRSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Br2Cl2S2/c13-5-1-9-11(3-7(5)15)18-10-2-6(14)8(16)4-12(10)17-9/h1-4H.
What are the key properties of 2,7-dibromo-3,8-dichlorothianthrene?
2,7-dibromo-3,8-dichlorothianthrene has a molecular weight of 443.01 g/mol, XLogP of 7.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-3,8-dichlorothianthrene is sourced from PubChem (CID 19906812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).