C12H4Br2Cl2S2 — CID 19906812
2,7-dibromo-3,8-dichlorothianthrene (PubChem CID 19906812) has the molecular formula C12H4Br2Cl2S2 and a molecular weight of 443.01 g/mol. Its IUPAC name is 2,7-dibromo-3,8-dichlorothianthrene.
| Compound Name | 2,7-dibromo-3,8-dichlorothianthrene |
|---|---|
| PubChem CID | 19906812 |
| Molecular Formula | C12H4Br2Cl2S2 |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 439.75 |
| IUPAC Name | 2,7-dibromo-3,8-dichlorothianthrene |
| SMILES | Clc1cc2c(cc1Br)Sc1cc(Cl)c(Br)cc1S2 |
| InChI | InChI=1S/C12H4Br2Cl2S2/c13-5-1-9-11(3-7(5)15)18-10-2-6(14)8(16)4-12(10)17-9/h1-4H |
| InChIKey | XEECZUOYJVXRSU-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |