C12H3Br6N — CID 71370431
1,2,3,6,7,8-hexabromo-9H-carbazole (PubChem CID 71370431) has the molecular formula C12H3Br6N and a molecular weight of 640.59 g/mol. Its IUPAC name is 1,2,3,6,7,8-hexabromo-9H-carbazole.
| Compound Name | 1,2,3,6,7,8-hexabromo-9H-carbazole |
|---|---|
| PubChem CID | 71370431 |
| Molecular Formula | C12H3Br6N |
| Molecular Weight | 640.59 g/mol |
| Exact Mass | 634.54 |
| IUPAC Name | 1,2,3,6,7,8-hexabromo-9H-carbazole |
| SMILES | Brc1cc2c([nH]c3c(Br)c(Br)c(Br)cc32)c(Br)c1Br |
| InChI | InChI=1S/C12H3Br6N/c13-5-1-3-4-2-6(14)8(16)10(18)12(4)19-11(3)9(17)7(5)15/h1-2,19H |
| InChIKey | OTNHHKXTYSAHFW-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.59 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|