C14H6Br2O — CID 123634923
4,5-dibromo-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-1,3,5,7,9,11,13-heptaene (PubChem CID 123634923) has the molecular formula C14H6Br2O and a molecular weight of 350.01 g/mol. Its IUPAC name is 4,5-dibromo-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 4,5-dibromo-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 123634923 |
| Molecular Formula | C14H6Br2O |
| Molecular Weight | 350.01 g/mol |
| Exact Mass | 347.88 |
| IUPAC Name | 4,5-dibromo-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-1,3,5,7,9,11,13-heptaene |
| SMILES | Brc1cc2c(cc1Br)c1oc2c2ccccc21 |
| InChI | InChI=1S/C14H6Br2O/c15-11-5-9-10(6-12(11)16)14-8-4-2-1-3-7(8)13(9)17-14/h1-6H |
| InChIKey | QFFLNJLWOXHDMD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.01 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|