C18H8Br4 — CID 59787236
2,3,5,12-tetrabromotetracene (PubChem CID 59787236) has the molecular formula C18H8Br4 and a molecular weight of 543.88 g/mol. Its IUPAC name is 2,3,5,12-tetrabromotetracene.
| Compound Name | 2,3,5,12-tetrabromotetracene |
|---|---|
| PubChem CID | 59787236 |
| Molecular Formula | C18H8Br4 |
| Molecular Weight | 543.88 g/mol |
| Exact Mass | 539.74 |
| IUPAC Name | 2,3,5,12-tetrabromotetracene |
| SMILES | Brc1cc2c(Br)c3cc4ccccc4cc3c(Br)c2cc1Br |
| InChI | InChI=1S/C18H8Br4/c19-15-7-13-14(8-16(15)20)18(22)12-6-10-4-2-1-3-9(10)5-11(12)17(13)21/h1-8H |
| InChIKey | SVROXHZAWAAYAE-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.88 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|