C6HBr3Cl2 — CID 643343
1,2,3-tribromo-4,5-dichlorobenzene (PubChem CID 643343) has the molecular formula C6HBr3Cl2 and a molecular weight of 383.69 g/mol. Its IUPAC name is 1,2,3-tribromo-4,5-dichlorobenzene.
| Compound Name | 1,2,3-tribromo-4,5-dichlorobenzene |
|---|---|
| PubChem CID | 643343 |
| Molecular Formula | C6HBr3Cl2 |
| Molecular Weight | 383.69 g/mol |
| Exact Mass | 379.70 |
| IUPAC Name | 1,2,3-tribromo-4,5-dichlorobenzene |
| SMILES | Clc1cc(Br)c(Br)c(Br)c1Cl |
| InChI | InChI=1S/C6HBr3Cl2/c7-2-1-3(10)6(11)5(9)4(2)8/h1H |
| InChIKey | WDXJIPLWOSHPNC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|