About 1,2,3-tribromo-4,5-dichlorobenzene
1,2,3-tribromo-4,5-dichlorobenzene (PubChem CID 643343) has the molecular formula C6HBr3Cl2
and a molecular weight of 383.69 g/mol. Its IUPAC name is 1,2,3-tribromo-4,5-dichlorobenzene.
Molecular Properties
| Compound Name | 1,2,3-tribromo-4,5-dichlorobenzene |
| PubChem CID | 643343 |
| Molecular Formula | C6HBr3Cl2 |
| Molecular Weight | 383.69 g/mol |
| Exact Mass | 379.70 |
| IUPAC Name | 1,2,3-tribromo-4,5-dichlorobenzene |
| SMILES | Clc1cc(Br)c(Br)c(Br)c1Cl |
| InChI | InChI=1S/C6HBr3Cl2/c7-2-1-3(10)6(11)5(9)4(2)8/h1H |
| InChIKey | WDXJIPLWOSHPNC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-tribromo-4,5-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-tribromo-4,5-dichlorobenzene?
The IUPAC name of 1,2,3-tribromo-4,5-dichlorobenzene (CID 643343) is 1,2,3-tribromo-4,5-dichlorobenzene.
What is the SMILES notation for 1,2,3-tribromo-4,5-dichlorobenzene?
The canonical SMILES for 1,2,3-tribromo-4,5-dichlorobenzene is Clc1cc(Br)c(Br)c(Br)c1Cl.
What is the InChIKey of 1,2,3-tribromo-4,5-dichlorobenzene?
The InChIKey is WDXJIPLWOSHPNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HBr3Cl2/c7-2-1-3(10)6(11)5(9)4(2)8/h1H.
What are the key properties of 1,2,3-tribromo-4,5-dichlorobenzene?
1,2,3-tribromo-4,5-dichlorobenzene has a molecular weight of 383.69 g/mol, XLogP of 5.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-tribromo-4,5-dichlorobenzene is sourced from PubChem (CID 643343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).