C12H5BrCl4 — CID 101423965
1-(4-bromo-3-chlorophenyl)-2,3,5-trichlorobenzene (PubChem CID 101423965) has the molecular formula C12H5BrCl4 and a molecular weight of 370.89 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-2,3,5-trichlorobenzene.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-2,3,5-trichlorobenzene |
|---|---|
| PubChem CID | 101423965 |
| Molecular Formula | C12H5BrCl4 |
| Molecular Weight | 370.89 g/mol |
| Exact Mass | 367.83 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-2,3,5-trichlorobenzene |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2ccc(Br)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H5BrCl4/c13-9-2-1-6(3-10(9)15)8-4-7(14)5-11(16)12(8)17/h1-5H |
| InChIKey | VYCOQTBZQWKCBV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.89 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|