C10H5Cl3S — CID 130088556
3-(2,3,5-trichlorophenyl)thiophene (PubChem CID 130088556) has the molecular formula C10H5Cl3S and a molecular weight of 263.58 g/mol. Its IUPAC name is 3-(2,3,5-trichlorophenyl)thiophene.
| Compound Name | 3-(2,3,5-trichlorophenyl)thiophene |
|---|---|
| PubChem CID | 130088556 |
| Molecular Formula | C10H5Cl3S |
| Molecular Weight | 263.58 g/mol |
| Exact Mass | 261.92 |
| IUPAC Name | 3-(2,3,5-trichlorophenyl)thiophene |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2ccsc2)c1 |
| InChI | InChI=1S/C10H5Cl3S/c11-7-3-8(6-1-2-14-5-6)10(13)9(12)4-7/h1-5H |
| InChIKey | KJATXXZVBGTPIB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|