C17H7Cl6N — CID 134637222
2,5-bis(2,3,5-trichlorophenyl)pyridine (PubChem CID 134637222) has the molecular formula C17H7Cl6N and a molecular weight of 437.97 g/mol. Its IUPAC name is 2,5-bis(2,3,5-trichlorophenyl)pyridine.
| Compound Name | 2,5-bis(2,3,5-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134637222 |
| Molecular Formula | C17H7Cl6N |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 434.87 |
| IUPAC Name | 2,5-bis(2,3,5-trichlorophenyl)pyridine |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2ccc(-c3cc(Cl)cc(Cl)c3Cl)nc2)c1 |
| InChI | InChI=1S/C17H7Cl6N/c18-9-3-11(16(22)13(20)5-9)8-1-2-15(24-7-8)12-4-10(19)6-14(21)17(12)23/h1-7H |
| InChIKey | KGICSMPXOFBIED-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|