C10H4Cl4N2 — CID 24902237
4-chloro-6-(2,3,5-trichlorophenyl)pyrimidine (PubChem CID 24902237) has the molecular formula C10H4Cl4N2 and a molecular weight of 293.97 g/mol. Its IUPAC name is 4-chloro-6-(2,3,5-trichlorophenyl)pyrimidine.
| Compound Name | 4-chloro-6-(2,3,5-trichlorophenyl)pyrimidine |
|---|---|
| PubChem CID | 24902237 |
| Molecular Formula | C10H4Cl4N2 |
| Molecular Weight | 293.97 g/mol |
| Exact Mass | 291.91 |
| IUPAC Name | 4-chloro-6-(2,3,5-trichlorophenyl)pyrimidine |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2cc(Cl)ncn2)c1 |
| InChI | InChI=1S/C10H4Cl4N2/c11-5-1-6(10(14)7(12)2-5)8-3-9(13)16-4-15-8/h1-4H |
| InChIKey | KBSUUNPDQREEHZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.97 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|