C13H9Cl3N2O2 — CID 133087054
methyl 5-amino-2-(2,3,5-trichlorophenyl)pyridine-4-carboxylate (PubChem CID 133087054) has the molecular formula C13H9Cl3N2O2 and a molecular weight of 331.59 g/mol. Its IUPAC name is methyl 5-amino-2-(2,3,5-trichlorophenyl)pyridine-4-carboxylate.
| Compound Name | methyl 5-amino-2-(2,3,5-trichlorophenyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 133087054 |
| Molecular Formula | C13H9Cl3N2O2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | methyl 5-amino-2-(2,3,5-trichlorophenyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2cc(Cl)cc(Cl)c2Cl)ncc1N |
| InChI | InChI=1S/C13H9Cl3N2O2/c1-20-13(19)7-4-11(18-5-10(7)17)8-2-6(14)3-9(15)12(8)16/h2-5H,17H2,1H3 |
| InChIKey | BRINUDFJTLOLMK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|