C13H7Cl3FNO2 — CID 133090464
methyl 5-fluoro-2-(2,3,6-trichlorophenyl)pyridine-4-carboxylate (PubChem CID 133090464) has the molecular formula C13H7Cl3FNO2 and a molecular weight of 334.56 g/mol. Its IUPAC name is methyl 5-fluoro-2-(2,3,6-trichlorophenyl)pyridine-4-carboxylate.
| Compound Name | methyl 5-fluoro-2-(2,3,6-trichlorophenyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 133090464 |
| Molecular Formula | C13H7Cl3FNO2 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | methyl 5-fluoro-2-(2,3,6-trichlorophenyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2c(Cl)ccc(Cl)c2Cl)ncc1F |
| InChI | InChI=1S/C13H7Cl3FNO2/c1-20-13(19)6-4-10(18-5-9(6)17)11-7(14)2-3-8(15)12(11)16/h2-5H,1H3 |
| InChIKey | MSZHPDGMLUVCBZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|