C17H18ClNO2 — CID 59678159
methyl 4-chloro-6-(2,6-diethylphenyl)pyridine-3-carboxylate (PubChem CID 59678159) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is methyl 4-chloro-6-(2,6-diethylphenyl)pyridine-3-carboxylate.
| Compound Name | methyl 4-chloro-6-(2,6-diethylphenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59678159 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | methyl 4-chloro-6-(2,6-diethylphenyl)pyridine-3-carboxylate |
| SMILES | CCc1cccc(CC)c1-c1cc(Cl)c(C(=O)OC)cn1 |
| InChI | InChI=1S/C17H18ClNO2/c1-4-11-7-6-8-12(5-2)16(11)15-9-14(18)13(10-19-15)17(20)21-3/h6-10H,4-5H2,1-3H3 |
| InChIKey | FDZWFZPIFSAHPP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |