C13H7Cl4NO2 — CID 133087927
methyl 6-chloro-2-(2,3,6-trichlorophenyl)pyridine-3-carboxylate (PubChem CID 133087927) has the molecular formula C13H7Cl4NO2 and a molecular weight of 351.02 g/mol. Its IUPAC name is methyl 6-chloro-2-(2,3,6-trichlorophenyl)pyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-2-(2,3,6-trichlorophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133087927 |
| Molecular Formula | C13H7Cl4NO2 |
| Molecular Weight | 351.02 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | methyl 6-chloro-2-(2,3,6-trichlorophenyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)nc1-c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H7Cl4NO2/c1-20-13(19)6-2-5-9(16)18-12(6)10-7(14)3-4-8(15)11(10)17/h2-5H,1H3 |
| InChIKey | ZLGGRQHQJRINOQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.02 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|