C11H4Cl4N2O2 — CID 119024598
2-chloro-3-nitro-5-(2,3,5-trichlorophenyl)pyridine (PubChem CID 119024598) has the molecular formula C11H4Cl4N2O2 and a molecular weight of 337.98 g/mol. Its IUPAC name is 2-chloro-3-nitro-5-(2,3,5-trichlorophenyl)pyridine.
| Compound Name | 2-chloro-3-nitro-5-(2,3,5-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 119024598 |
| Molecular Formula | C11H4Cl4N2O2 |
| Molecular Weight | 337.98 g/mol |
| Exact Mass | 335.90 |
| IUPAC Name | 2-chloro-3-nitro-5-(2,3,5-trichlorophenyl)pyridine |
| SMILES | O=[N+]([O-])c1cc(-c2cc(Cl)cc(Cl)c2Cl)cnc1Cl |
| InChI | InChI=1S/C11H4Cl4N2O2/c12-6-2-7(10(14)8(13)3-6)5-1-9(17(18)19)11(15)16-4-5/h1-4H |
| InChIKey | QQFFSEXEIIKOHJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.98 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|