C8H7ClN2O4 — CID 118585912
2-chloro-5-(1,3-dioxolan-2-yl)-3-nitropyridine (PubChem CID 118585912) has the molecular formula C8H7ClN2O4 and a molecular weight of 230.61 g/mol. Its IUPAC name is 2-chloro-5-(1,3-dioxolan-2-yl)-3-nitropyridine.
| Compound Name | 2-chloro-5-(1,3-dioxolan-2-yl)-3-nitropyridine |
|---|---|
| PubChem CID | 118585912 |
| Molecular Formula | C8H7ClN2O4 |
| Molecular Weight | 230.61 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 2-chloro-5-(1,3-dioxolan-2-yl)-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(C2OCCO2)cnc1Cl |
| InChI | InChI=1S/C8H7ClN2O4/c9-7-6(11(12)13)3-5(4-10-7)8-14-1-2-15-8/h3-4,8H,1-2H2 |
| InChIKey | CYRMWURPHPNGJE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|