C9H8BrNO4 — CID 121228647
2-(3-bromo-5-nitrophenyl)-1,3-dioxolane (PubChem CID 121228647) has the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. Its IUPAC name is 2-(3-bromo-5-nitrophenyl)-1,3-dioxolane.
| Compound Name | 2-(3-bromo-5-nitrophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 121228647 |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 2-(3-bromo-5-nitrophenyl)-1,3-dioxolane |
| SMILES | O=[N+]([O-])c1cc(Br)cc(C2OCCO2)c1 |
| InChI | InChI=1S/C9H8BrNO4/c10-7-3-6(9-14-1-2-15-9)4-8(5-7)11(12)13/h3-5,9H,1-2H2 |
| InChIKey | HJDQZMGUPYCUSP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|