C10H8BrNO6 — CID 59176027
7-bromo-5-(1,3-dioxolan-2-yl)-4-nitro-1,3-benzodioxole (PubChem CID 59176027) has the molecular formula C10H8BrNO6 and a molecular weight of 318.08 g/mol. Its IUPAC name is 7-bromo-5-(1,3-dioxolan-2-yl)-4-nitro-1,3-benzodioxole.
| Compound Name | 7-bromo-5-(1,3-dioxolan-2-yl)-4-nitro-1,3-benzodioxole |
|---|---|
| PubChem CID | 59176027 |
| Molecular Formula | C10H8BrNO6 |
| Molecular Weight | 318.08 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 7-bromo-5-(1,3-dioxolan-2-yl)-4-nitro-1,3-benzodioxole |
| SMILES | O=[N+]([O-])c1c(C2OCCO2)cc(Br)c2c1OCO2 |
| InChI | InChI=1S/C10H8BrNO6/c11-6-3-5(10-15-1-2-16-10)7(12(13)14)9-8(6)17-4-18-9/h3,10H,1-2,4H2 |
| InChIKey | OUGPEWOBKRQZOF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.08 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|