C9H7F2NO4 — CID 118095403
2-(2,6-difluoro-3-nitrophenyl)-1,3-dioxolane (PubChem CID 118095403) has the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-nitrophenyl)-1,3-dioxolane.
| Compound Name | 2-(2,6-difluoro-3-nitrophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 118095403 |
| Molecular Formula | C9H7F2NO4 |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-(2,6-difluoro-3-nitrophenyl)-1,3-dioxolane |
| SMILES | O=[N+]([O-])c1ccc(F)c(C2OCCO2)c1F |
| InChI | InChI=1S/C9H7F2NO4/c10-5-1-2-6(12(13)14)8(11)7(5)9-15-3-4-16-9/h1-2,9H,3-4H2 |
| InChIKey | CVKQZNNIZQYIDN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|