C11H10F2N2O4 — CID 113322130
2,6-difluoro-3-nitro-N-(oxolan-3-yl)benzamide (PubChem CID 113322130) has the molecular formula C11H10F2N2O4 and a molecular weight of 272.21 g/mol. Its IUPAC name is 2,6-difluoro-3-nitro-N-(oxolan-3-yl)benzamide.
| Compound Name | 2,6-difluoro-3-nitro-N-(oxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 113322130 |
| Molecular Formula | C11H10F2N2O4 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2,6-difluoro-3-nitro-N-(oxolan-3-yl)benzamide |
| SMILES | O=C(NC1CCOC1)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C11H10F2N2O4/c12-7-1-2-8(15(17)18)10(13)9(7)11(16)14-6-3-4-19-5-6/h1-2,6H,3-5H2,(H,14,16) |
| InChIKey | WLLZGKFOANIQJG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|