C10H9F2N3O3 — CID 79773195
N-(2-aminocyclopropyl)-2,6-difluoro-3-nitrobenzamide (PubChem CID 79773195) has the molecular formula C10H9F2N3O3 and a molecular weight of 257.20 g/mol. Its IUPAC name is N-(2-aminocyclopropyl)-2,6-difluoro-3-nitrobenzamide.
| Compound Name | N-(2-aminocyclopropyl)-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 79773195 |
| Molecular Formula | C10H9F2N3O3 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | N-(2-aminocyclopropyl)-2,6-difluoro-3-nitrobenzamide |
| SMILES | NC1CC1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C10H9F2N3O3/c11-4-1-2-7(15(17)18)9(12)8(4)10(16)14-6-3-5(6)13/h1-2,5-6H,3,13H2,(H,14,16) |
| InChIKey | ZJLKVYNAIDBKAP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|