C8H6F2N4O4 — CID 79772861
[(2,6-difluoro-3-nitrobenzoyl)amino]urea (PubChem CID 79772861) has the molecular formula C8H6F2N4O4 and a molecular weight of 260.16 g/mol. Its IUPAC name is [(2,6-difluoro-3-nitrobenzoyl)amino]urea.
| Compound Name | [(2,6-difluoro-3-nitrobenzoyl)amino]urea |
|---|---|
| PubChem CID | 79772861 |
| Molecular Formula | C8H6F2N4O4 |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | [(2,6-difluoro-3-nitrobenzoyl)amino]urea |
| SMILES | NC(=O)NNC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C8H6F2N4O4/c9-3-1-2-4(14(17)18)6(10)5(3)7(15)12-13-8(11)16/h1-2H,(H,12,15)(H3,11,13,16) |
| InChIKey | VAPOAFHFSNZFCC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|