C12H13F2N3O3 — CID 79773409
N-(2-aminocyclopentyl)-2,6-difluoro-3-nitrobenzamide (PubChem CID 79773409) has the molecular formula C12H13F2N3O3 and a molecular weight of 285.25 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-2,6-difluoro-3-nitrobenzamide.
| Compound Name | N-(2-aminocyclopentyl)-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 79773409 |
| Molecular Formula | C12H13F2N3O3 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(2-aminocyclopentyl)-2,6-difluoro-3-nitrobenzamide |
| SMILES | NC1CCCC1NC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H13F2N3O3/c13-6-4-5-9(17(19)20)11(14)10(6)12(18)16-8-3-1-2-7(8)15/h4-5,7-8H,1-3,15H2,(H,16,18) |
| InChIKey | SKYKURBDUAGVIS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|