C12H11BrF2N2O3 — CID 80661523
N-(2-bromocyclopentyl)-2,6-difluoro-3-nitrobenzamide (PubChem CID 80661523) has the molecular formula C12H11BrF2N2O3 and a molecular weight of 349.13 g/mol. Its IUPAC name is N-(2-bromocyclopentyl)-2,6-difluoro-3-nitrobenzamide.
| Compound Name | N-(2-bromocyclopentyl)-2,6-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 80661523 |
| Molecular Formula | C12H11BrF2N2O3 |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | N-(2-bromocyclopentyl)-2,6-difluoro-3-nitrobenzamide |
| SMILES | O=C(NC1CCCC1Br)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H11BrF2N2O3/c13-6-2-1-3-8(6)16-12(18)10-7(14)4-5-9(11(10)15)17(19)20/h4-6,8H,1-3H2,(H,16,18) |
| InChIKey | MFJUTENJTJKXOE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|