C10H10F2N2O2 — CID 130039488
3-(2,6-difluoro-3-nitrophenyl)pyrrolidine (PubChem CID 130039488) has the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. Its IUPAC name is 3-(2,6-difluoro-3-nitrophenyl)pyrrolidine.
| Compound Name | 3-(2,6-difluoro-3-nitrophenyl)pyrrolidine |
|---|---|
| PubChem CID | 130039488 |
| Molecular Formula | C10H10F2N2O2 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-(2,6-difluoro-3-nitrophenyl)pyrrolidine |
| SMILES | O=[N+]([O-])c1ccc(F)c(C2CCNC2)c1F |
| InChI | InChI=1S/C10H10F2N2O2/c11-7-1-2-8(14(15)16)10(12)9(7)6-3-4-13-5-6/h1-2,6,13H,3-5H2 |
| InChIKey | GLUCJEHVSIREKZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|