C8H4BrNO5 — CID 59176011
7-bromo-4-nitro-1,3-benzodioxole-5-carbaldehyde (PubChem CID 59176011) has the molecular formula C8H4BrNO5 and a molecular weight of 274.03 g/mol. Its IUPAC name is 7-bromo-4-nitro-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 7-bromo-4-nitro-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 59176011 |
| Molecular Formula | C8H4BrNO5 |
| Molecular Weight | 274.03 g/mol |
| Exact Mass | 272.93 |
| IUPAC Name | 7-bromo-4-nitro-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc(Br)c2c(c1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C8H4BrNO5/c9-5-1-4(2-11)6(10(12)13)8-7(5)14-3-15-8/h1-2H,3H2 |
| InChIKey | FOHLRPLYVPQBQO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.03 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|