C9H8NO4- — CID 7176187
2-formyl-3,5-dimethyl-4-nitrophenolate (PubChem CID 7176187) has the molecular formula C9H8NO4- and a molecular weight of 194.17 g/mol. Its IUPAC name is 2-formyl-3,5-dimethyl-4-nitrophenolate.
| Compound Name | 2-formyl-3,5-dimethyl-4-nitrophenolate |
|---|---|
| PubChem CID | 7176187 |
| Molecular Formula | C9H8NO4- |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-formyl-3,5-dimethyl-4-nitrophenolate |
| SMILES | Cc1cc([O-])c(C=O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9NO4/c1-5-3-8(12)7(4-11)6(2)9(5)10(13)14/h3-4,12H,1-2H3/p-1 |
| InChIKey | NCSALOCTEZUWBR-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|