C13H11N3O2 — CID 3680100
2-[(2,4,6-trimethyl-3-nitrophenyl)methylidene]propanedinitrile (PubChem CID 3680100) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[(2,4,6-trimethyl-3-nitrophenyl)methylidene]propanedinitrile.
| Compound Name | 2-[(2,4,6-trimethyl-3-nitrophenyl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 3680100 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[(2,4,6-trimethyl-3-nitrophenyl)methylidene]propanedinitrile |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)c1C=C(C#N)C#N |
| InChI | InChI=1S/C13H11N3O2/c1-8-4-9(2)13(16(17)18)10(3)12(8)5-11(6-14)7-15/h4-5H,1-3H3 |
| InChIKey | OBMADVGQTPOTBC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|