C7H4BrNO4 — CID 167014546
4-bromo-7-nitro-1,3-benzodioxole (PubChem CID 167014546) has the molecular formula C7H4BrNO4 and a molecular weight of 246.02 g/mol. Its IUPAC name is 4-bromo-7-nitro-1,3-benzodioxole.
| Compound Name | 4-bromo-7-nitro-1,3-benzodioxole |
|---|---|
| PubChem CID | 167014546 |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.02 g/mol |
| Exact Mass | 244.93 |
| IUPAC Name | 4-bromo-7-nitro-1,3-benzodioxole |
| SMILES | O=[N+]([O-])c1ccc(Br)c2c1OCO2 |
| InChI | InChI=1S/C7H4BrNO4/c8-4-1-2-5(9(10)11)7-6(4)12-3-13-7/h1-2H,3H2 |
| InChIKey | NYVKKJCWYPUNPJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.02 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|