About 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole
5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole (PubChem CID 118640946) has the molecular formula C10H9BrO4
and a molecular weight of 273.08 g/mol. Its IUPAC name is 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole |
| PubChem CID | 118640946 |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole |
| SMILES | Brc1ccc2c(c1C1OCCO1)OCO2 |
| InChI | InChI=1S/C10H9BrO4/c11-6-1-2-7-9(15-5-14-7)8(6)10-12-3-4-13-10/h1-2,10H,3-5H2 |
| InChIKey | MBYUBNGREYTTOZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole?
The IUPAC name of 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole (CID 118640946) is 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole.
What is the SMILES notation for 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole?
The canonical SMILES for 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole is Brc1ccc2c(c1C1OCCO1)OCO2.
What is the InChIKey of 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole?
The InChIKey is MBYUBNGREYTTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO4/c11-6-1-2-7-9(15-5-14-7)8(6)10-12-3-4-13-10/h1-2,10H,3-5H2.
What are the key properties of 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole?
5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole has a molecular weight of 273.08 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-(1,3-dioxolan-2-yl)-1,3-benzodioxole is sourced from PubChem (CID 118640946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).