C10H8BrNO3 — CID 170877122
(E)-3-(5-bromo-1,3-benzodioxol-4-yl)prop-2-enamide (PubChem CID 170877122) has the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. Its IUPAC name is (E)-3-(5-bromo-1,3-benzodioxol-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-1,3-benzodioxol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170877122 |
| Molecular Formula | C10H8BrNO3 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | (E)-3-(5-bromo-1,3-benzodioxol-4-yl)prop-2-enamide |
| SMILES | NC(=O)/C=C/c1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C10H8BrNO3/c11-7-2-3-8-10(15-5-14-8)6(7)1-4-9(12)13/h1-4H,5H2,(H2,12,13)/b4-1+ |
| InChIKey | AJBUHAUAHFEHLS-DAFODLJHSA-N |
| XLogP | 1.68 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|